This page aims to list articles on Wikipedia that describe particular biomolecules or types of biomolecules. This list is not necessarily complete or up to date - if you see an article that should be here but isn't (or one that shouldn't be here but is), please update the page accordingly. ''See also:'' List of compounds, Chemical compound, Organic compound, List of organic compounds, biochemistry. __NOTOC__ == A == For substances with an A- or α- prefix such as a-amylase, please see the parent page (in this case Amylase). * Abamectin * Abietic acid * Acetic acid * Acetylcholine * Adenosine * Adenosine diphosphate (ADP) * Adenosine monophosphate (AMP) * Adenosine triphosphate (ATP) * Adenylate cyclase * Adonitol * Adrenaline, epinephrine * Adrenocorticotropic hormone (ACTH) * Aflatoxin * Agar * Alanine * Albumin * Aldosterone * Alpha-amanitin * Allantoin * α-Amanatin, see Alpha-amanitin * Amino acid * Anethole * Angiotensinogen * Amylase (also see a-amylase) * Angiotensinogen * Antidiuretic hormone (ADH) * Arabinose * Arginine * Ascorbic acid (vitamin C) * Asparagine * Aspartic acid''Italic text'' * Atrial-natriuretic peptide (ANP) * Azadirachtin A – C35H44O16 == B == *Bacteriocin *Bicuculline *Bilirubin *Biopolymer *Biotin (Vitamin H) *Brucine == C == * Cadaverine * Caffeine * Calciferol (Vitamin D) * calcitonin * Calmodulin * Calmodulin * Calreticulin * Camphor * Cannabinol * Capsaicin * Carbohydrase * Carbohydrate * Carnitine * Carrageenan * Casein * Caspase * Cellulase * Cellulose * Chaparonin * Chitin * a-chloralose * Chlorophyll * Cholecystokinin (CCK) * Cholesterol * Choline * Chondroitin and Chondroitin sulfate * Cinnamaldehyde * Citral * Citric acid * Citronellal * Citronellol * Citrulline * Cobalamin (Vitamin B12) * Coenzyme * Coenzyme Q * Colchicine * Collagen * Coniine * Corticosteroid * Corticosterone * Corticotropin-releasing hormone (CRH) * Cortisol * Creatine * Creatine kinase * Crystallin * Alpha-cyclodextrin * Cysteine * Cystine * Cytidine * Cytochrome * Cytochrome C * Cytochrome c oxidase * Cytochrome c peroxidase * Cytokine * Cytosine – C4H5N3O == D == *Deoxycholic acid *Deoxyribofuranose *Deoxyribose *Deoxyribose nucleic acid (DNA) *Dextran *Dextrin *Deoxyribose nucleic acid *Dopamine == E == *Enzyme *Ephedrine *Epinephrine – C9H13NO3 *Erucic acid – CH3(CH2)7CH=CH(CH2)11COOH *Erythritol *Erythropoietin (EPO) *Estradiol *Eugenol == F == * Fatty acid * Fibrin * Fibronectin * Folic acid (Vitamin M) * Follicle stimulating hormone (FSH) * Formaldehyde * Formic acid == G == *Gamma globulin *Galactose *Gamma globulin *Gamma-aminobutyric acid *Gamma-butyrolactone *Gamma-hydroxybutyrate (GHB) *Gastrin *Gelatin *Geraniol *Globulin *Glucagon *Glucose – C6H12O6 *Glucose oxidase *Gluten *Glutamic acid *Glutamine *Glutathione *Gluten *Glycerin (glycerol) *Glycine *Glycogen *Glycolic acid *Glycolipid *Glycoprotein *Gonadotropin-releasing hormone (GnRH) *Granzyme *Green fluorescent protein *Growth hormone *Growth hormone-releasing hormone (GHRH) *GTPase *Guanine *Guanosine *Guanosine triphosphate (+GTP) == H == *Haptoglobin *Hematoxylin *Heme *Hemerythrin *Hemocyanin *Hemoglobin *Hemoprotein *High density lipoprotein, HDL *Histamine *Histidine *Histone *Histone methyltransferase *HLA antigen *Homocysteine *Hormone *Human chorionic gonadotrophin (HCG) *Human growth hormone *Hyaluronidase *Hydrogen peroxide *Hydroxyproline *5-Hydroxytryptamine == I == *Indigo *Indole *Inosine *Inositol *Insulin *Insulin-like growth factor *Integrin *Integral membrane protein *Integrin *Integrase *Intein *Interferon *Inulin *Ionone *Isoleucine *Iron-sulfur cluster == J == == K == *Keratin *Kinase == L == For substances with an l- or L- prefix such as L-alanine or DL-alanine, please see the parent page (in this case alanine). *Lactase *Lactic acid *Lactose *Lanolin *Lauric acid *Leptin *Leucine *Lignin *Limonene *Linalool *Linoleic acid *Linolenic acid *Lipase *Lipid *Lipid anchored protein *Lipoamide *Lipoprotein *Low density lipoprotein,LDL *Luteinizing hormone (LH) *Lycopene *Lysine *Lysozyme == M == *Malic acid *Maltose *Melatonin *Membrane protein *Metalloprotein *Metallothionein *Methionine *Monomer *Myoglobin == N == *Naphthoquinone (Vitamin K) *Niacin or nicotinic acid (Vitamin B3) *Nitrocellulose *Neurotransmitter *noradrenaline, norepinephrine *Nuclease *Nucleotide *Nucleic acid *Nucleoside *Nucleotide == O == *Oestrogens *Oligopeptide *Orcin *Orexin *Ornithine *Oxalic acid *Oxidase *Oxytocin == P == *Para-Aminobenzoic acid *Paclitaxel *Palimitic acid *Pantothenic acid (Vitamin B5) *parathyroid hormone (PTH) *Paraprotein *Pardaxin *Peptidase *Pepsin *Peptide *Peripheral membrane protein *Phenethylamine *Phenylalanine *Phosphagen *phosphatase *Phospholipid *Phenylalanine *Phytic acid *Plant hormones *Polypeptide *Polyphenol *Polysaccharide *Porphyrin *Prion *Progesterone *Prolactin (PRL) *Proline *Propanoic acid *Protamine *Protease *Protein *Proteinoid *Putrescine *Pyrethrin *Pyridoxine or pyridoxamine (Vitamin B6) *Pyrrolysine *Pyruvic acid == Q == *Quinone == R == *Raffinose *Renin *Retinene *Retinol (Vitamin A) *Riboflavin (Vitamin B2) *Ribofuranose, Ribose *Ricin *RNA - Ribonucleic acid == S == * Safrole * Salicylaldehyde * Salicylic acid * Salvinorin-A – C23H28O8 * Saponin * Secretin * Selenocysteine * Selenomethionine * Selenoprotein * Seratonin * Serine * Serine kinase * Serotonin * Skatole * Signal recognition particle * Somatostatin * Sorbic acid * Squalene * Stearic acid * Sterol * Strychnine * Sucrose (sugar) * Sugars (in general) * superoxide == T == *Tannic acid *Tannin *Tartaric acid *Taurine *Tetrodotoxin *Thaumatin *Topoisomerase *Tyrosine kinase *Taurine *Testosterone *Tetrodotoxin *Thaumatin *Thiamine (Vitamin B1) – C12H17ClN4OSulfur·HCl *Threonine *Thrombopoietin *Thymidine *Thymine *Thiamine (Vitamin B1) *Thyroid-stimulating hormone (TSH) *Thyrotropin-releasing hormone (TRH) *Thyroxine (T4) *Tocopherol (Vitamin E) *Topoisomerase *Triiodothyronine (T3) *Transmembrane receptor *Trophic hormone *Trypsin *Tryptophan *Tubulin *Tyrosine == U == * Ubiquitin * Uracil * Urea * Urease * Uric acid – C5H4N4O3 * Uridine * Uridine == V == * Valine * Vanabins * Vitamins (in general) * Vitamin A (retinol) * Vitamin B () ** Vitamin B1 (thiamine) ** Vitamin B2 (riboflavin) ** Vitamin B3 (niacin or nicotinic acid) ** Vitamin B4 (adenine) ** Vitamin B5 (panthothenic acid) ** Vitamin B6 (pyridoxine or pyridoxamine) ** Vitamin B12 (cobalamin) * Vitamin C (ascorbic acid) * Vitamin D (calciferol) * Vitamin E (tocopherol) * Vitamin F * Vitamin H (biotin) * Vitamin K (naphthoquinone) * Vitamin M (folic acid) * Vitamin P (niacin or nicotinic acid) * Vitamin S == W == * Water == X == * Xylose == Y == == Z == Biochemicals [[Category:Lists|Biomolecules]
I think this article needs a different title or some kind of statement of purpose. The list of all biomolecules could be taken to include every gene product of every genome, every transcript from which they derive, every intron that was spliced out, etc. I assume we don't want all that. User:168... 04:58, 21 Nov 2003 (UTC) : As it says in the first sentence (with emphasis added): "This page aims to list articles on Wikipedia that describe particular biomolecules or types of biomolecules." If you to add an article for every gene product, sure, go ahead and list them :-/ User:Stewartadcock 05:23, 21 Nov 2003 (UTC) == Break up of List of compounds == The page List of compounds has grown very large (64kB or so) and unwieldy, so the Talk:List_of_compounds#propose_dividing_list_into_2_web_pages was made to split the page. I have been working on this. The initial proposal was for list of inorganic compounds and list of organic compounds, and these pages have been created, with heavy pruning of non-existent or obscure compounds, as well as generic terms like "carbohydrates". However the organic list is still very large and likely to grow- one way to bring it down a lot would be to remove things such as large proteins and enzymes (that are not simple organic molecules) and place them here (if they're not here already). Thus compounds like glucose and pinene would remain on both lists, but things like a-amylase and Corticotropin-releasing_hormone would only be found here. Of course there are grey areas- alanine belongs on both, but I would like just to place dipeptides here does this seem reasonable? I'm an organic chemist but I'm pretty weak on biochemistry, so please tell me if I'm going wrong, before I spend a lot of time on this. The ultimate goal would be to make ''List of compounds'' into an elaborate redirect page, sending people here, or to ''List of organic compounds'' or to ''List of inorganic compounds''. User:Walkerma 00:02, 11 Apr 2005 (UTC)
See other meanings of words starting from letter:
Words begining with List_of_biomolecules:
List_of_biomolecules
List_of_biomolecules
List of biomolecules
This page aims to list articles on Wikipedia that describe particular biomolecules or types of biomolecules. This list is not necessarily complete or up to date - if you see an article that should be here but isn't (or one that shouldn't be here but is), please update the page accordingly. ''See also:'' List of compounds, Chemical compound, Organic compound, List of organic compounds, biochemistry. __NOTOC__ == A == For substances with an A- or α- prefix such as a-amylase, please see the parent page (in this case Amylase). * Abamectin * Abietic acid * Acetic acid * Acetylcholine * Adenosine * Adenosine diphosphate (ADP) * Adenosine monophosphate (AMP) * Adenosine triphosphate (ATP) * Adenylate cyclase * Adonitol * Adrenaline, epinephrine * Adrenocorticotropic hormone (ACTH) * Aflatoxin * Agar * Alanine * Albumin * Aldosterone * Alpha-amanitin * Allantoin * α-Amanatin, see Alpha-amanitin * Amino acid * Anethole * Angiotensinogen * Amylase (also see a-amylase) * Angiotensinogen * Antidiuretic hormone (ADH) * Arabinose * Arginine * Ascorbic acid (vitamin C) * Asparagine * Aspartic acid''Italic text'' * Atrial-natriuretic peptide (ANP) * Azadirachtin A – C35H44O16 == B == *Bacteriocin *Bicuculline *Bilirubin *Biopolymer *Biotin (Vitamin H) *Brucine == C == * Cadaverine * Caffeine * Calciferol (Vitamin D) * calcitonin * Calmodulin * Calmodulin * Calreticulin * Camphor * Cannabinol * Capsaicin * Carbohydrase * Carbohydrate * Carnitine * Carrageenan * Casein * Caspase * Cellulase * Cellulose * Chaparonin * Chitin * a-chloralose * Chlorophyll * Cholecystokinin (CCK) * Cholesterol * Choline * Chondroitin and Chondroitin sulfate * Cinnamaldehyde * Citral * Citric acid * Citronellal * Citronellol * Citrulline * Cobalamin (Vitamin B12) * Coenzyme * Coenzyme Q * Colchicine * Collagen * Coniine * Corticosteroid * Corticosterone * Corticotropin-releasing hormone (CRH) * Cortisol * Creatine * Creatine kinase * Crystallin * Alpha-cyclodextrin * Cysteine * Cystine * Cytidine * Cytochrome * Cytochrome C * Cytochrome c oxidase * Cytochrome c peroxidase * Cytokine * Cytosine – C4H5N3O == D == *Deoxycholic acid *Deoxyribofuranose *Deoxyribose *Deoxyribose nucleic acid (DNA) *Dextran *Dextrin *Deoxyribose nucleic acid *Dopamine == E == *Enzyme *Ephedrine *Epinephrine – C9H13NO3 *Erucic acid – CH3(CH2)7CH=CH(CH2)11COOH *Erythritol *Erythropoietin (EPO) *Estradiol *Eugenol == F == * Fatty acid * Fibrin * Fibronectin * Folic acid (Vitamin M) * Follicle stimulating hormone (FSH) * Formaldehyde * Formic acid == G == *Gamma globulin *Galactose *Gamma globulin *Gamma-aminobutyric acid *Gamma-butyrolactone *Gamma-hydroxybutyrate (GHB) *Gastrin *Gelatin *Geraniol *Globulin *Glucagon *Glucose – C6H12O6 *Glucose oxidase *Gluten *Glutamic acid *Glutamine *Glutathione *Gluten *Glycerin (glycerol) *Glycine *Glycogen *Glycolic acid *Glycolipid *Glycoprotein *Gonadotropin-releasing hormone (GnRH) *Granzyme *Green fluorescent protein *Growth hormone *Growth hormone-releasing hormone (GHRH) *GTPase *Guanine *Guanosine *Guanosine triphosphate (+GTP) == H == *Haptoglobin *Hematoxylin *Heme *Hemerythrin *Hemocyanin *Hemoglobin *Hemoprotein *High density lipoprotein, HDL *Histamine *Histidine *Histone *Histone methyltransferase *HLA antigen *Homocysteine *Hormone *Human chorionic gonadotrophin (HCG) *Human growth hormone *Hyaluronidase *Hydrogen peroxide *Hydroxyproline *5-Hydroxytryptamine == I == *Indigo *Indole *Inosine *Inositol *Insulin *Insulin-like growth factor *Integrin *Integral membrane protein *Integrin *Integrase *Intein *Interferon *Inulin *Ionone *Isoleucine *Iron-sulfur cluster == J == == K == *Keratin *Kinase == L == For substances with an l- or L- prefix such as L-alanine or DL-alanine, please see the parent page (in this case alanine). *Lactase *Lactic acid *Lactose *Lanolin *Lauric acid *Leptin *Leucine *Lignin *Limonene *Linalool *Linoleic acid *Linolenic acid *Lipase *Lipid *Lipid anchored protein *Lipoamide *Lipoprotein *Low density lipoprotein,LDL *Luteinizing hormone (LH) *Lycopene *Lysine *Lysozyme == M == *Malic acid *Maltose *Melatonin *Membrane protein *Metalloprotein *Metallothionein *Methionine *Monomer *Myoglobin == N == *Naphthoquinone (Vitamin K) *Niacin or nicotinic acid (Vitamin B3) *Nitrocellulose *Neurotransmitter *noradrenaline, norepinephrine *Nuclease *Nucleotide *Nucleic acid *Nucleoside *Nucleotide == O == *Oestrogens *Oligopeptide *Orcin *Orexin *Ornithine *Oxalic acid *Oxidase *Oxytocin == P == *Para-Aminobenzoic acid *Paclitaxel *Palimitic acid *Pantothenic acid (Vitamin B5) *parathyroid hormone (PTH) *Paraprotein *Pardaxin *Peptidase *Pepsin *Peptide *Peripheral membrane protein *Phenethylamine *Phenylalanine *Phosphagen *phosphatase *Phospholipid *Phenylalanine *Phytic acid *Plant hormones *Polypeptide *Polyphenol *Polysaccharide *Porphyrin *Prion *Progesterone *Prolactin (PRL) *Proline *Propanoic acid *Protamine *Protease *Protein *Proteinoid *Putrescine *Pyrethrin *Pyridoxine or pyridoxamine (Vitamin B6) *Pyrrolysine *Pyruvic acid == Q == *Quinone == R == *Raffinose *Renin *Retinene *Retinol (Vitamin A) *Riboflavin (Vitamin B2) *Ribofuranose, Ribose *Ricin *RNA - Ribonucleic acid == S == * Safrole * Salicylaldehyde * Salicylic acid * Salvinorin-A – C23H28O8 * Saponin * Secretin * Selenocysteine * Selenomethionine * Selenoprotein * Seratonin * Serine * Serine kinase * Serotonin * Skatole * Signal recognition particle * Somatostatin * Sorbic acid * Squalene * Stearic acid * Sterol * Strychnine * Sucrose (sugar) * Sugars (in general) * superoxide == T == *Tannic acid *Tannin *Tartaric acid *Taurine *Tetrodotoxin *Thaumatin *Topoisomerase *Tyrosine kinase *Taurine *Testosterone *Tetrodotoxin *Thaumatin *Thiamine (Vitamin B1) – C12H17ClN4OSulfur·HCl *Threonine *Thrombopoietin *Thymidine *Thymine *Thiamine (Vitamin B1) *Thyroid-stimulating hormone (TSH) *Thyrotropin-releasing hormone (TRH) *Thyroxine (T4) *Tocopherol (Vitamin E) *Topoisomerase *Triiodothyronine (T3) *Transmembrane receptor *Trophic hormone *Trypsin *Tryptophan *Tubulin *Tyrosine == U == * Ubiquitin * Uracil * Urea * Urease * Uric acid – C5H4N4O3 * Uridine * Uridine == V == * Valine * Vanabins * Vitamins (in general) * Vitamin A (retinol) * Vitamin B () ** Vitamin B1 (thiamine) ** Vitamin B2 (riboflavin) ** Vitamin B3 (niacin or nicotinic acid) ** Vitamin B4 (adenine) ** Vitamin B5 (panthothenic acid) ** Vitamin B6 (pyridoxine or pyridoxamine) ** Vitamin B12 (cobalamin) * Vitamin C (ascorbic acid) * Vitamin D (calciferol) * Vitamin E (tocopherol) * Vitamin F * Vitamin H (biotin) * Vitamin K (naphthoquinone) * Vitamin M (folic acid) * Vitamin P (niacin or nicotinic acid) * Vitamin S == W == * Water == X == * Xylose == Y == == Z == Biochemicals [[Category:Lists|Biomolecules]
List of biomolecules
I think this article needs a different title or some kind of statement of purpose. The list of all biomolecules could be taken to include every gene product of every genome, every transcript from which they derive, every intron that was spliced out, etc. I assume we don't want all that. User:168... 04:58, 21 Nov 2003 (UTC) : As it says in the first sentence (with emphasis added): "This page aims to list articles on Wikipedia that describe particular biomolecules or types of biomolecules." If you to add an article for every gene product, sure, go ahead and list them :-/ User:Stewartadcock 05:23, 21 Nov 2003 (UTC) == Break up of List of compounds == The page List of compounds has grown very large (64kB or so) and unwieldy, so the Talk:List_of_compounds#propose_dividing_list_into_2_web_pages was made to split the page. I have been working on this. The initial proposal was for list of inorganic compounds and list of organic compounds, and these pages have been created, with heavy pruning of non-existent or obscure compounds, as well as generic terms like "carbohydrates". However the organic list is still very large and likely to grow- one way to bring it down a lot would be to remove things such as large proteins and enzymes (that are not simple organic molecules) and place them here (if they're not here already). Thus compounds like glucose and pinene would remain on both lists, but things like a-amylase and Corticotropin-releasing_hormone would only be found here. Of course there are grey areas- alanine belongs on both, but I would like just to place dipeptides here does this seem reasonable? I'm an organic chemist but I'm pretty weak on biochemistry, so please tell me if I'm going wrong, before I spend a lot of time on this. The ultimate goal would be to make ''List of compounds'' into an elaborate redirect page, sending people here, or to ''List of organic compounds'' or to ''List of inorganic compounds''. User:Walkerma 00:02, 11 Apr 2005 (UTC)
See other meanings of words starting from letter:
L
LA | LB | LC | LD | LE | LF | LG | LH | LI | LJ | LK | LM | LN | LO | LP | LR | LS | LT | LU | LW | LX | LY | LZ |Words begining with List_of_biomolecules:
List_of_biomolecules
List_of_biomolecules
These materials are based on Wikipedia and licensed under the GNU FDL
YouTube.com videos better site than Turbo Tax 2007
